* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VOACAMIDINE |
CAS: | 6897-04-7 |
English Synonyms: | VOACAMIDINE |
MDL Number.: | MFCD11111299 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CC[C@H]1CC2C[C@@]3([C@H]1N(C2)CCc4c3[nH]c5c4c(c(cc5)OC)[C@@H]6C[C@@H]\7[C@@H]([C@H](Cc8c6[nH]c9c8cccc9)N(C/C7=C/C)C)C(=O)OC)C(=O)OC |
InChi: | InChI=1S/C43H52N4O5/c1-7-24-17-23-20-43(42(49)52-6)39-27(15-16-47(21-23)40(24)43)35-32(45-39)13-14-34(50-4)37(35)30-18-28-25(8-2)22-46(3)33(36(28)41(48)51-5)19-29-26-11-9-10-12-31(26)44-38(29)30/h8-14,23-24,28,30,33,36,40,44-45H,7,15-22H2,1-6H3/b25-8-/t23?,24-,28-,30-,33-,36-,40-,43+/m0/s1 |
InChiKey: | InChIKey=PSTDKFQDHNZGAL-QWEKBEMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.