* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE |
CAS: | 69141-73-7 |
English Synonyms: | 7-METHYL-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE ; [1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE, 7-METHYL- |
MDL Number.: | MFCD11044709 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1cc2ncnn2cn1 |
InChi: | InChI=1S/C6H6N4/c1-5-2-6-7-3-9-10(6)4-8-5/h2-4H,1H3 |
InChiKey: | InChIKey=TYJLNLYMINXCRQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.