* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GOMISIN N |
CAS: | 69176-52-9 |
English Synonyms: | GOMISIN N |
MDL Number.: | MFCD00887634 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | C[C@H]1Cc2cc3c(c(c2-c4c(cc(c(c4OC)OC)OC)C[C@H]1C)OC)OCO3 |
InChi: | InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m1/s1 |
InChiKey: | InChIKey=RTZKSTLPRTWFEV-OLZOCXBDSA-N |
Property |
|
Comments: | ASSAY (HPLC) |
Specification: | GUARANTEED REAGENT |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.