* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VUFB-10542 |
CAS: | 69195-59-1 |
English Synonyms: | VUFB-10542 |
MDL Number.: | MFCD01730793 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CN(CC#C)C1Cc2ccccc2Sc3c1cc(cc3)Cl.C(=C\C(=O)O)\C(=O)O |
InChi: | InChI=1S/C18H16ClNS.C4H4O4/c1-3-10-20(2)16-11-13-6-4-5-7-17(13)21-18-9-8-14(19)12-15(16)18;5-3(6)1-2-4(7)8/h1,4-9,12,16H,10-11H2,2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
InChiKey: | InChIKey=CPHFJYTUNFXNBV-BTJKTKAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.