* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRANS 2-METHYL-3-HEXENE |
CAS: | 3899-36-3 ;692-24-0 |
English Synonyms: | (3E)-2-METHYLHEX-3-ENE ; TRANS 2-METHYL-3-HEXENE |
MDL Number.: | MFCD00039946 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC/C=C/C(C)C |
InChi: | InChI=1S/C7H14/c1-4-5-6-7(2)3/h5-7H,4H2,1-3H3/b6-5+ |
InChiKey: | InChIKey=IQANHWBWTVLDTP-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.