* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1R,2R,3R,5S)-(-)-ISOPINOCAMPHEYLAMINE |
CAS: | 69460-11-3 |
English Synonyms: | (1R,2R,3R,5S)-(-)-ISOPINOCAMPHENYLAMINE ; (1R,2R,3R,5S)-2,6,6-TRIMETHYL-BICYCLO[3.1.1]HEPTAN-3-AMINE ; (-)-ISOPINOCAMPHEYLAMINE ; (1R,2R,3R,5S)-(-)-ISOPINOCAMPHEYLAMINE ; (1R,2R,3R,5S)-3-PINANAMINE |
MDL Number.: | MFCD00192238 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C[C@@H]1[C@H]2C[C@H](C2(C)C)C[C@H]1N |
InChi: | InChI=1S/C10H19N/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9H,4-5,11H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
InChiKey: | InChIKey=VPTSZLVPZCTAHZ-BZNPZCIMSA-N |
Property |
|
Boiling Point: | 90 DEG C/18 MMHG(LIT) |
Density: | DENSITY: 0.909 G/ML AT 25 DEG C(LIT) |
Physical Property: | FLASHPOINT: 161.6 DEG F FLASHPOINT: 72 DEG C REFRACTIVE INDEX: N20/D 1.48(LIT) |
Comments: | OPTICAL ACTIVITY: [ALPHA]21/D -42 DEG, NEAT UNSPSC: 12352100 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H315-H319-H335 |
Precautionary statements: | P261-P305 + P351 + P338 |
hazard symbol: | Xi |
Risk Code: | R:36/37/38 |
Safe Code: | S:26-36 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.