* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(PROP-2-EN-1-YL)BENZENE-1,3,5-TRIOL |
CAS: | 69693-10-3 |
English Synonyms: | 2-ALLYLBENZENE-1,3,5-TRIOL ; 2-(PROP-2-EN-1-YL)BENZENE-1,3,5-TRIOL |
MDL Number.: | MFCD16251697 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | C=CCc1c(cc(cc1O)O)O |
InChi: | InChI=1S/C9H10O3/c1-2-3-7-8(11)4-6(10)5-9(7)12/h2,4-5,10-12H,1,3H2 |
InChiKey: | InChIKey=CWVMJXXYYVRDPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.