* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S)-3-METHYLOXOLANE-2,5-DIONE |
CAS: | 6973-20-2 |
English Synonyms: | (3S)-DIHYDRO-3-METHYL-2,5-FURANDIONE ; (3S)-3-METHYLOXOLANE-2,5-DIONE |
MDL Number.: | MFCD11052546 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@H]1CC(=O)OC1=O |
InChi: | InChI=1S/C5H6O3/c1-3-2-4(6)8-5(3)7/h3H,2H2,1H3/t3-/m0/s1 |
InChiKey: | InChIKey=DFATXMYLKPCSCX-VKHMYHEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.