* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,7-DIMETHYL-1H-INDENE |
CAS: | 6974-97-6 |
English Synonyms: | 4,7-DIMETHYL-1H-INDENE |
MDL Number.: | MFCD06797433 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1ccc(c2c1CC=C2)C |
InChi: | InChI=1S/C11H12/c1-8-6-7-9(2)11-5-3-4-10(8)11/h3-4,6-7H,5H2,1-2H3 |
InChiKey: | InChIKey=DKLQZDIAQKGVTA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.