* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | (4R)-4-(2-HYDROXYETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE |
| CAS: | 70005-89-9 |
| EnglishSynonyms: | (R)-2-(2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)ETHANOL ; (R)-4-(2-HYDROXYETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE ; (R)-2,2-DIMETHYL-4-HYDROXYETHYL-[1,3]DIOXOLANE ; (4R)-4-(2-HYDROXYETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE |
| pro_mdlNumber: | MFCD02682966 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC1(OC[C@H](O1)CCO)C |
| InChi: | InChI=1S/C7H14O3/c1-7(2)9-5-6(10-7)3-4-8/h6,8H,3-5H2,1-2H3/t6-/m1/s1 |
| InChiKey: | InChIKey=YYEZYENJAMOWHW-ZCFIWIBFSA-N |
|
|
| Boiling_Point: | 207 DEG C(LIT) |
| Density: | DENSITY: 1.045 G/ML AT 25 DEG C(LIT) |
| PhysicalProperty: | FLASHPOINT: 106 DEG C FLASHPOINT: 222.8 DEG F REFRACTIVE INDEX: N20/D 1.4390(LIT) |
| Comments: | UNSPSC: 12352100 WGK: 3 |
|
|
| secure_symbol: |
GHS07
|
| secure_signal_word: | Warning |
| secure_risk_stmt: | H315-H319-H335 |
| secure_cautionary_stmt: | P261-P305 + P351 + P338 |
| secure_damage_code: | Xi |
| secure_risk_disclosure_stmt: | R:36/37/38 |
| secure_security_stmt: | S:26-36 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.