* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XENTHIORATE |
| CAS: | 7009-79-2 |
| English Synonyms: | XENTHIORATE |
| MDL Number.: | MFCD00868834 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCC(c1ccc(cc1)c2ccccc2)C(=O)SCCN(CC)CC |
| InChi: | InChI=1S/C22H29NOS/c1-4-21(22(24)25-17-16-23(5-2)6-3)20-14-12-19(13-15-20)18-10-8-7-9-11-18/h7-15,21H,4-6,16-17H2,1-3H3 |
| InChiKey: | InChIKey=PFNLUFYAGHJNKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.