* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | S-PETASIN |
CAS: | 70238-51-6 |
English Synonyms: | (3S,4AR,5R,6R)-[2,3,4,4A,5,6,7,8-OCTAHYDRO-3-(2-PROPENYL)-4A,5-DIMETHYL-2-OXO-6-NAPHTHYL] Z-3'-METHYLTHIO-1'-PROPENOATE ; S-PETASIN |
MDL Number.: | MFCD04040021 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@H]1[C@@H](CCC2=CC(=O)[C@@H](C[C@]12C)C(=C)C)OC(=O)/C=C\SC |
InChi: | InChI=1S/C19H26O3S/c1-12(2)15-11-19(4)13(3)17(22-18(21)8-9-23-5)7-6-14(19)10-16(15)20/h8-10,13,15,17H,1,6-7,11H2,2-5H3/b9-8-/t13-,15-,17+,19+/m0/s1 |
InChiKey: | InChIKey=OHANKWLYFDFHOJ-RFTFGCRPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.