* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(2-FURYL)-1,3-OXAZOLE |
CAS: | 70380-67-5 |
English Synonyms: | 5-FUR-2-YL-1,3-OXAZOLE ; 5-(2-FURANYL)OXAZOLE ; 5-FURAN-2-YL-OXAZOLE ; 5-(FURAN-2-YL)-1,3-OXAZOLE ; 5-(2-FURYL)-1,3-OXAZOLE |
MDL Number.: | MFCD00085092 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(oc1)c2cnco2 |
InChi: | InChI=1S/C7H5NO2/c1-2-6(9-3-1)7-4-8-5-10-7/h1-5H |
InChiKey: | InChIKey=LYPXTVWBKURKQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.