* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETISOMICIN |
| CAS: | 70639-48-4 |
| English Synonyms: | ETISOMICIN |
| MDL Number.: | MFCD00864972 |
| H bond acceptor: | 12 |
| H bond donor: | 8 |
| Smile: | CCN[C@@H]1[C@H]([C@H](OC[C@]1(C)O)O[C@H]2[C@@H](C[C@@H](C([C@@H]2O)O[C@@H]3[C@@H](CC=C(O3)CN)N)N)N)O |
| InChi: | InChI=1S/C20H39N5O7/c1-3-25-17-14(27)19(29-8-20(17,2)28)32-16-12(24)6-11(23)15(13(16)26)31-18-10(22)5-4-9(7-21)30-18/h4,10-19,25-28H,3,5-8,21-24H2,1-2H3/t10-,11+,12-,13+,14-,15?,16+,17-,18-,19-,20+/m1/s1 |
| InChiKey: | InChIKey=KOBHYGXJFZRQFP-ATFVJSGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.