* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-AZIDO-9H-PURINE |
CAS: | 7086-34-2 |
English Synonyms: | 6-AZIDO-9H-PURINE |
MDL Number.: | MFCD13189439 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1[nH]c2c(n1)c(ncn2)N=[N+]=[N-] |
InChi: | InChI=1S/C5H3N7/c6-12-11-5-3-4(8-1-7-3)9-2-10-5/h1-2H,(H,7,8,9,10) |
InChiKey: | InChIKey=PNRIXVQOZMTFOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.