* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ECGONINE ETHYL ESTER |
| CAS: | 70939-97-8 |
| English Synonyms: | ECGONINE ETHYL ESTER |
| MDL Number.: | MFCD00798475 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)[C@@H]1[C@H]2CC[C@H](N2C)C[C@@H]1O |
| InChi: | InChI=1S/C11H19NO3/c1-3-15-11(14)10-8-5-4-7(12(8)2)6-9(10)13/h7-10,13H,3-6H2,1-2H3/t7-,8+,9-,10+/m0/s1 |
| InChiKey: | InChIKey=ABDMBNAKYBUEEX-QCLAVDOMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.