* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,3-BIS(2-HYDROXYETHYL)URACIL |
CAS: | 711-66-0 |
English Synonyms: | 1,3-BIS(2-HYDROXYETHYL)URACIL |
MDL Number.: | MFCD00154743 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cn(c(=O)n(c1=O)CCO)CCO |
InChi: | InChI=1S/C8H12N2O4/c11-5-3-9-2-1-7(13)10(4-6-12)8(9)14/h1-2,11-12H,3-6H2 |
InChiKey: | InChIKey=AKEISPWDGKTJAB-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.