* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUADAZOCINE |
| CAS: | 71276-43-2 |
| English Synonyms: | QUADAZOCINE |
| MDL Number.: | MFCD00864501 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@]12CCN([C@H](C1(C)CCC(=O)CCC3CCCC3)Cc4c2cc(cc4)O)C |
| InChi: | InChI=1S/C25H37NO2/c1-24-14-15-26(3)23(16-19-9-11-21(28)17-22(19)24)25(24,2)13-12-20(27)10-8-18-6-4-5-7-18/h9,11,17-18,23,28H,4-8,10,12-16H2,1-3H3/t23-,24+,25?/m0/s1 |
| InChiKey: | InChIKey=LOYWOYCPSWPKFH-ZXABPTRBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.