* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BROMO-5,6,7,8-TETRAHYDROQUINOLINE |
CAS: | 71308-91-3 |
English Synonyms: | 2-BROMO-5,6,7,8-TETRAHYDROQUINOLINE |
MDL Number.: | MFCD11848715 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(nc2c1CCCC2)Br |
InChi: | InChI=1S/C9H10BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h5-6H,1-4H2 |
InChiKey: | InChIKey=GJKJABMIDAWWHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.