* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-((4-AMINO-5-(4-CL-PH)-4H-1,2,4-TRIAZOL-3-YL)THIO)-N-(2-MEO-5-ME-PH)ACETAMIDE |
CAS: | 713099-80-0 |
English Synonyms: | 2-((4-AMINO-5-(4-CL-PH)-4H-1,2,4-TRIAZOL-3-YL)THIO)-N-(2-MEO-5-ME-PH)ACETAMIDE |
MDL Number.: | MFCD04024906 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1ccc(c(c1)NC(=O)CSc2nnc(n2N)c3ccc(cc3)Cl)OC |
InChi: | InChI=1S/C18H18ClN5O2S/c1-11-3-8-15(26-2)14(9-11)21-16(25)10-27-18-23-22-17(24(18)20)12-4-6-13(19)7-5-12/h3-9H,10,20H2,1-2H3,(H,21,25) |
InChiKey: | InChIKey=KQZRGQGQTLODJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.