* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-CHLOROINDOLE |
CAS: | 7135-31-1 |
English Synonyms: | 1H-INDOLE, 2-CHLORO- ; 2-CHLORO-1H-INDOLE ; 2-CHLOROINDOLE |
MDL Number.: | MFCD04117990 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)cc([nH]2)Cl |
InChi: | InChI=1S/C8H6ClN/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5,10H |
InChiKey: | InChIKey=HBZHNVUMFPGVHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.