* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZINE |
CAS: | 71472-58-7 |
English Synonyms: | 7-METHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZINE |
MDL Number.: | MFCD17014030 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccc2c(c1)OCCN2 |
InChi: | InChI=1S/C9H11NO/c1-7-2-3-8-9(6-7)11-5-4-10-8/h2-3,6,10H,4-5H2,1H3 |
InChiKey: | InChIKey=HHFJHCXBGHXHLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.