Molecular Structure:
CAS No.:
71573-77-8
Product Name.:
CCD No.:CCD03256738
Formula:C8 H6 O4
MolWeight:166.131
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BIS(PROP-2-YN-1-YL) OXALATE |
| CAS： | 71573-77-8 |
| English Synonyms： | BIS(PROP-2-YN-1-YL) OXALATE ; DI-2-PROPYNYL OXALATE |
| MDL Number.： | MFCD16876720 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | C#CCOC(=O)C(=O)OCC#C |
| InChi： | InChI=1S/C8H6O4/c1-3-5-11-7(9)8(10)12-6-4-2/h1-2H,5-6H2 |
| InChiKey： | InChIKey=URWVQLWOBPHQCH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
