* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1S-N2-ETHYL-PROPANE-1,2-DIAMINE |
CAS: | 71754-73-9 |
English Synonyms: | 1S-N2-ETHYL-PROPANE-1,2-DIAMINE |
MDL Number.: | MFCD11975909 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCN[C@@H](C)CN |
InChi: | InChI=1S/C5H14N2/c1-3-7-5(2)4-6/h5,7H,3-4,6H2,1-2H3/t5-/m0/s1 |
InChiKey: | InChIKey=BNKSAALXGVBEIG-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.