* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-PRO-SER-OH |
CAS: | 71835-80-8 |
English Synonyms: | H-PRO-SER-OH |
MDL Number.: | MFCD00083811 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | C1C[C@H](NC1)C(=O)N[C@@H](CO)C(=O)O |
InChi: | InChI=1S/C8H14N2O4/c11-4-6(8(13)14)10-7(12)5-2-1-3-9-5/h5-6,9,11H,1-4H2,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
InChiKey: | InChIKey=AFWBWPCXSWUCLB-WDSKDSINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.