* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-CHLOROPHENYL)-1H-PYRROLE |
| CAS: | 71845-14-2 |
| English Synonyms: | 3-(2-CHLOROPHENYL)-1H-PYRROLE |
| MDL Number.: | MFCD09832514 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)c2cc[nH]c2)Cl |
| InChi: | InChI=1S/C10H8ClN/c11-10-4-2-1-3-9(10)8-5-6-12-7-8/h1-7,12H |
| InChiKey: | InChIKey=BMEUPZMTSYBPLS-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.