* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(ACETYLOXY)-2(1H)-PYRIDINONE |
CAS: | 71847-90-0 |
English Synonyms: | 5-(ACETYLOXY)-2(1H)-PYRIDINONE |
MDL Number.: | MFCD17012091 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)Oc1ccc(=O)[nH]c1 |
InChi: | InChI=1S/C7H7NO3/c1-5(9)11-6-2-3-7(10)8-4-6/h2-4H,1H3,(H,8,10) |
InChiKey: | InChIKey=JLGWWEQRFGMMHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.