* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,9-DICHLORO-1,2,3,4-TETRAHYDRO-ACRIDINE |
CAS: | 720710-47-4 |
English Synonyms: | 5,9-DICHLORO-1,2,3,4-TETRAHYDRO-ACRIDINE |
MDL Number.: | MFCD11849282 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc2c(c(c1)Cl)nc3c(c2Cl)CCCC3 |
InChi: | InChI=1S/C13H11Cl2N/c14-10-6-3-5-9-12(15)8-4-1-2-7-11(8)16-13(9)10/h3,5-6H,1-2,4,7H2 |
InChiKey: | InChIKey=LFUIEBDIPIYFNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.