* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1,1-TRIFLUORO-5-PHENYL-2,4-PENTANEDIONE |
CAS: | 721-96-0 |
English Synonyms: | 1,1,1-TRIFLUORO-5-PHENYL-2,4-PENTANEDIONE |
MDL Number.: | MFCD11849500 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)CC(=O)CC(=O)C(F)(F)F |
InChi: | InChI=1S/C11H9F3O2/c12-11(13,14)10(16)7-9(15)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
InChiKey: | InChIKey=OVRDABGVYJAEBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.