* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-(1-ACETYL-1H-PYRAZOL-3-YL)-ACETAMIDE |
| CAS: | 72159-25-2 |
| English Synonyms: | N-(1-ACETYL-1H-PYRAZOL-3-YL)-ACETAMIDE |
| MDL Number.: | MFCD16620131 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(=O)Nc1ccn(n1)C(=O)C |
| InChi: | InChI=1S/C7H9N3O2/c1-5(11)8-7-3-4-10(9-7)6(2)12/h3-4H,1-2H3,(H,8,9,11) |
| InChiKey: | InChIKey=YEHHRASFWBJZEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.