* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-THR-OTBU |
| CAS: | 72289-51-1 |
| English Synonyms: | Z-THR-OTBU |
| MDL Number.: | MFCD00191153 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C[C@H]([C@@H](C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1)O |
| InChi: | InChI=1S/C16H23NO5/c1-11(18)13(14(19)22-16(2,3)4)17-15(20)21-10-12-8-6-5-7-9-12/h5-9,11,13,18H,10H2,1-4H3,(H,17,20)/t11-,13+/m1/s1 |
| InChiKey: | InChIKey=ZRQUTSHDNGTITM-YPMHNXCESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.