Molecular Structure:
CAS No.:
72324-39-1
Product Name.:
CCD No.:CCD00384315
Formula:C8 H10 O5
MolWeight:186.162
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(14)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(5)
|
|
| Product Name： | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE |
| CAS： | 72324-39-1 |
| English Synonyms： | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE |
| MDL Number.： | MFCD03425724 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CC(=O)C1C(=O)OC(OC1=O)(C)C |
| InChi： | InChI=1S/C8H10O5/c1-4(9)5-6(10)12-8(2,3)13-7(5)11/h5H,1-3H3 |
| InChiKey： | InChIKey=BTJDMDJIAAHSRG-UHFFFAOYSA-N |
|
|
| Melting Point： | 83-85 DEG |
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
