* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(4-ACETYLPHENYL)-3-ETHYLUREA |
CAS: | 72531-14-7 |
English Synonyms: | 1-(4-ACETYLPHENYL)-3-ETHYLUREA |
MDL Number.: | MFCD00027756 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCNC(=O)Nc1ccc(cc1)C(=O)C |
InChi: | InChI=1S/C11H14N2O2/c1-3-12-11(15)13-10-6-4-9(5-7-10)8(2)14/h4-7H,3H2,1-2H3,(H2,12,13,15) |
InChiKey: | InChIKey=NFOPSQHXHGGAMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.