* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,4,6,7-TETRAMETHYLQUINOLINE |
CAS: | 72681-40-4 |
English Synonyms: | 2,4,6,7-TETRAMETHYLQUINOLINE |
MDL Number.: | MFCD00272408 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cc(nc2c1cc(c(c2)C)C)C |
InChi: | InChI=1S/C13H15N/c1-8-6-12-10(3)5-11(4)14-13(12)7-9(8)2/h5-7H,1-4H3 |
InChiKey: | InChIKey=ATWTWGXHWNHOCR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.