Molecular Structure:
CAS No.:
72839-09-9
Product Name.:
CCD No.:CCD01991283
Formula:C8 H5 N O
MolWeight:131.133
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1-(2-PYRIDINYL)-2-PROPYN-1-ONE |
| CAS： | 72839-09-9 |
| English Synonyms： | 2-PROPYN-1-ONE, 1-(2-PYRIDINYL)- ; 1-(2-PYRIDINYL)-2-PROPYN-1-ONE ; 1-(PYRIDIN-2-YL)PROP-2-YN-1-ONE |
| MDL Number.： | MFCD13175777 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | C#CC(=O)c1ccccn1 |
| InChi： | InChI=1S/C8H5NO/c1-2-8(10)7-5-3-4-6-9-7/h1,3-6H |
| InChiKey： | InChIKey=NBSUPHVYLFCTAA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
