* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDO[2,3-B][1,4]BENZODIOXIN |
| CAS: | 72850-33-0 |
| English Synonyms: | [1,4]BENZODIOXINO[2,3-B]PYRIDINE ; PYRIDO[2,3-B][1,4]BENZODIOXIN |
| MDL Number.: | MFCD13181722 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)Oc3cccnc3O2 |
| InChi: | InChI=1S/C11H7NO2/c1-2-5-9-8(4-1)13-10-6-3-7-12-11(10)14-9/h1-7H |
| InChiKey: | InChIKey=PMKZEDFCVXHSIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.