* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2',4'-DIMETHOXY-[1,1'-BIPHENYL]-3-AMINE |
CAS: | 728919-20-8 |
English Synonyms: | 3-(2,4-DIMETHOXYPHENYL)ANILINE ; [1,1'-BIPHENYL]-3-AMINE, 2',4'-DIMETHOXY- ; 2',4'-DIMETHOXY-[1,1'-BIPHENYL]-3-AMINE |
MDL Number.: | MFCD04117428 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1ccc(c(c1)OC)c2cccc(c2)N |
InChi: | InChI=1S/C14H15NO2/c1-16-12-6-7-13(14(9-12)17-2)10-4-3-5-11(15)8-10/h3-9H,15H2,1-2H3 |
InChiKey: | InChIKey=XLSYCLUSWLUGGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.