* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PROLINE N-OCTYLAMIDE |
| CAS: | 72947-48-9 |
| English Synonyms: | L-PROLINE N-OCTYLAMIDE |
| MDL Number.: | MFCD00083067 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCNC(=O)[C@@H]1CCCN1 |
| InChi: | InChI=1S/C13H26N2O/c1-2-3-4-5-6-7-10-15-13(16)12-9-8-11-14-12/h12,14H,2-11H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChiKey: | InChIKey=WUYBQTRPOQBVEU-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.