* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIENO[3,2-B]PYRIDIN-5-AMINE |
CAS: | 73010-06-7 |
English Synonyms: | THIENO[3,2-B]PYRIDIN-5-AMINE |
MDL Number.: | MFCD17170116 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(nc2c1scc2)N |
InChi: | InChI=1S/C7H6N2S/c8-7-2-1-6-5(9-7)3-4-10-6/h1-4H,(H2,8,9) |
InChiKey: | InChIKey=KLVXXFGBNUEIES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.