* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,6-DIBROMO-9-(4-BROMO-PHENYL)-9H-CARBAZOLE |
CAS: | 73087-83-9 |
English Synonyms: | 3,6-DIBROMO-9-(4-BROMO-PHENYL)-9H-CARBAZOLE |
MDL Number.: | MFCD12024284 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(ccc1n2c3ccc(cc3c4c2ccc(c4)Br)Br)Br |
InChi: | InChI=1S/C18H10Br3N/c19-11-1-5-14(6-2-11)22-17-7-3-12(20)9-15(17)16-10-13(21)4-8-18(16)22/h1-10H |
InChiKey: | InChIKey=NRTDFHUSNYJENJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.