* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-INDOLE, 2-METHYL-6-PHENYL- |
CAS: | 73177-32-9 |
English Synonyms: | 1H-INDOLE, 2-METHYL-6-PHENYL- ; 2-METHYL-6-PHENYL-1H-INDOLE |
MDL Number.: | MFCD11976321 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1cc2ccc(cc2[nH]1)c3ccccc3 |
InChi: | InChI=1S/C15H13N/c1-11-9-14-8-7-13(10-15(14)16-11)12-5-3-2-4-6-12/h2-10,16H,1H3 |
InChiKey: | InChIKey=LUHAOVUAXLSXCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.