* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LEU-LEU ACETATE SALT |
CAS: | 73237-76-0 |
English Synonyms: | LEU-LEU ACETATE SALT |
MDL Number.: | MFCD00069974 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N.CC(=O)O |
InChi: | InChI=1S/C12H24N2O3.C2H4O2/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4;1-2(3)4/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17);1H3,(H,3,4)/t9-,10-;/m0./s1 |
InChiKey: | InChIKey=JEUHGRPWUPRNDP-IYPAPVHQSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.