* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ([4,5-BIS(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOL-3-YL]THIO)ACETIC ACID |
CAS: | 733031-06-6 |
English Synonyms: | ([4,5-BIS(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOL-3-YL]THIO)ACETIC ACID |
MDL Number.: | MFCD04635914 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1c2nnc(n2c3ccc(cc3)F)SCC(=O)O)F |
InChi: | InChI=1S/C16H11F2N3O2S/c17-11-3-1-10(2-4-11)15-19-20-16(24-9-14(22)23)21(15)13-7-5-12(18)6-8-13/h1-8H,9H2,(H,22,23) |
InChiKey: | InChIKey=XPUIWOLBUFCGNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.