* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-6-NITRO-2,3-DIHYDRO-IMIDAZO[2,1-B]OXAZOLE |
| CAS: | 73332-75-9 |
| English Synonyms: | 2-METHYL-6-NITRO-2H,3H-IMIDAZO[2,1-B][1,3]OXAZOLE ; 2-METHYL-6-NITRO-2,3-DIHYDRO-IMIDAZO[2,1-B]OXAZOLE |
| MDL Number.: | MFCD09263909 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1Cn2cc(nc2O1)[N+](=O)[O-] |
| InChi: | InChI=1S/C6H7N3O3/c1-4-2-8-3-5(9(10)11)7-6(8)12-4/h3-4H,2H2,1H3 |
| InChiKey: | InChIKey=NUCGDAFGCCIOTC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.