* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[(5-BROMOPYRIDIN-2-YL)OXY]ANILINE |
CAS: | 73474-63-2 |
English Synonyms: | 4-[(5-BROMOPYRIDIN-2-YL)OXY]ANILINE |
MDL Number.: | MFCD11650989 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(ccc1N)Oc2ccc(cn2)Br |
InChi: | InChI=1S/C11H9BrN2O/c12-8-1-6-11(14-7-8)15-10-4-2-9(13)3-5-10/h1-7H,13H2 |
InChiKey: | InChIKey=CDBZASLIQNCWPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.