* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISTAMYCIN X0 |
CAS: | 73522-72-2 |
English Synonyms: | ISTAMYCIN X0 |
MDL Number.: | MFCD01939667 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | CN[C@@H]1[C@H]([C@H](C[C@@H]([C@H]1O[C@@H]2[C@@H](CC[C@@H](O2)CN)N)N)OC)O |
InChi: | InChI=1S/C14H30N4O4/c1-18-11-12(19)10(20-2)5-9(17)13(11)22-14-8(16)4-3-7(6-15)21-14/h7-14,18-19H,3-6,15-17H2,1-2H3/t7-,8-,9+,10+,11-,12+,13-,14-/m1/s1 |
InChiKey: | InChIKey=BQZSSHRCXFZGPB-IZJMRDDUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.