* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 12,13-DIHYDRO-2,10-DIHYDROXY-5H-INDOLO[2,3-A]PYRROLO[3,4-C]CARBAZOLE-5,7(6H)-DIONE |
| CAS: | 73697-65-1 |
| English Synonyms: | 12,13-DIHYDRO-2,10-DIHYDROXY-5H-INDOLO[2,3-A]PYRROLO[3,4-C]CARBAZOLE-5,7(6H)-DIONE |
| MDL Number.: | MFCD17012200 |
| H bond acceptor: | 7 |
| H bond donor: | 5 |
| Smile: | c1cc2c(cc1O)[nH]c3c2c4c(c5c3[nH]c6c5ccc(c6)O)C(=O)NC4=O |
| InChi: | InChI=1S/C20H11N3O4/c24-7-1-3-9-11(5-7)21-17-13(9)15-16(20(27)23-19(15)26)14-10-4-2-8(25)6-12(10)22-18(14)17/h1-6,21-22,24-25H,(H,23,26,27) |
| InChiKey: | InChIKey=COUUDSNRXUXNDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.