* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CHLORO-4,5-DIMETHYL-1,3-OXAZOLE |
| CAS: | 73801-95-3 |
| English Synonyms: | 2-CHLORO-4,5-DIMETHYLOXAZOLE ; 2-CHLORO-4,5-DIMETHYL-1,3-OXAZOLE |
| MDL Number.: | MFCD16989261 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cc1c(oc(n1)Cl)C |
| InChi: | InChI=1S/C5H6ClNO/c1-3-4(2)8-5(6)7-3/h1-2H3 |
| InChiKey: | InChIKey=AEPSMLKSUJDZRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.