* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-CHLOROETHYL)-1,2,4,5-TETRAMETHYLBENZENE |
CAS: | 7383-68-8 |
English Synonyms: | 3-(2-CHLOROETHYL)-1,2,4,5-TETRAMETHYLBENZENE |
MDL Number.: | MFCD11110055 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1cc(c(c(c1C)CCCl)C)C |
InChi: | InChI=1S/C12H17Cl/c1-8-7-9(2)11(4)12(5-6-13)10(8)3/h7H,5-6H2,1-4H3 |
InChiKey: | InChIKey=LDSZVLDRUGEROB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.