Molecular Structure:
CAS No.:
741253-05-4
Product Name.:
CCD No.:CCD00358224
Formula:C8 H8 B N O2
MolWeight:160.967
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(52)
- Buyers(1)
- Spectrum(0)
- MSDS(0)
- Price(12)
|
|
| Product Name： | INDOLE-3-BORONIC ACID |
| CAS： | 741253-05-4 |
| English Synonyms： | INDOLE-3-BORONIC ACID ; ABLOCK AB-10-5311 ; 1H-INDOL-3-YLBORONIC ACID |
| MDL Number.： | MFCD03094806 |
| H bond acceptor： | 3 |
| H bond donor： | 3 |
| Smile： | B(c1c[nH]c2c1cccc2)(O)O |
| InChi： | InChI=1S/C8H8BNO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10-12H |
| InChiKey： | InChIKey=PTTHBZMGHRDZCV-UHFFFAOYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
